C20H19N7S — CID 19750419
1-propyl-5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazole-3-carbothialdehyde (PubChem CID 19750419) has the molecular formula C20H19N7S and a molecular weight of 389.49 g/mol. Its IUPAC name is 1-propyl-5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazole-3-carbothialdehyde.
| Compound Name | 1-propyl-5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazole-3-carbothialdehyde |
|---|---|
| PubChem CID | 19750419 |
| Molecular Formula | C20H19N7S |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 1-propyl-5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazole-3-carbothialdehyde |
| SMILES | CCCn1nc(C=S)nc1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C20H19N7S/c1-2-11-27-19(21-18(13-28)24-27)12-14-7-9-15(10-8-14)16-5-3-4-6-17(16)20-22-25-26-23-20/h3-10,13H,2,11-12H2,1H3,(H,22,23,25,26) |
| InChIKey | GSSGYNYYGRJWTC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|