C23H28N4O2 — CID 18700537
2-[5-[(2,5-dibutyl-1,2,4-triazol-3-yl)methyl]-2-pyridinyl]benzoic acid (PubChem CID 18700537) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-[5-[(2,5-dibutyl-1,2,4-triazol-3-yl)methyl]-2-pyridinyl]benzoic acid.
| Compound Name | 2-[5-[(2,5-dibutyl-1,2,4-triazol-3-yl)methyl]-2-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 18700537 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-[5-[(2,5-dibutyl-1,2,4-triazol-3-yl)methyl]-2-pyridinyl]benzoic acid |
| SMILES | CCCCc1nc(Cc2ccc(-c3ccccc3C(=O)O)nc2)n(CCCC)n1 |
| InChI | InChI=1S/C23H28N4O2/c1-3-5-11-21-25-22(27(26-21)14-6-4-2)15-17-12-13-20(24-16-17)18-9-7-8-10-19(18)23(28)29/h7-10,12-13,16H,3-6,11,14-15H2,1-2H3,(H,28,29) |
| InChIKey | SLTDCXMPKISOSW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |