C24H27N3O2 — CID 54016075
2-[4-[(5-but-2-enyl-3-butyl-1,2,4-triazol-1-yl)methyl]phenyl]benzoic acid (PubChem CID 54016075) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-[4-[(5-but-2-enyl-3-butyl-1,2,4-triazol-1-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(5-but-2-enyl-3-butyl-1,2,4-triazol-1-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 54016075 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 2-[4-[(5-but-2-enyl-3-butyl-1,2,4-triazol-1-yl)methyl]phenyl]benzoic acid |
| SMILES | CC=CCc1nc(CCCC)nn1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H27N3O2/c1-3-5-11-22-25-23(12-6-4-2)27(26-22)17-18-13-15-19(16-14-18)20-9-7-8-10-21(20)24(28)29/h4,6-10,13-16H,3,5,11-12,17H2,1-2H3,(H,28,29) |
| InChIKey | KVSIYOPDZXTURM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|