C21H19ClN2O2 — CID 91573972
2-[4-[(2-but-2-enyl-4-chloroimidazol-1-yl)methyl]phenyl]benzoic acid (PubChem CID 91573972) has the molecular formula C21H19ClN2O2 and a molecular weight of 366.85 g/mol. Its IUPAC name is 2-[4-[(2-but-2-enyl-4-chloroimidazol-1-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(2-but-2-enyl-4-chloroimidazol-1-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 91573972 |
| Molecular Formula | C21H19ClN2O2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 2-[4-[(2-but-2-enyl-4-chloroimidazol-1-yl)methyl]phenyl]benzoic acid |
| SMILES | CC=CCc1nc(Cl)cn1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H19ClN2O2/c1-2-3-8-20-23-19(22)14-24(20)13-15-9-11-16(12-10-15)17-6-4-5-7-18(17)21(25)26/h2-7,9-12,14H,8,13H2,1H3,(H,25,26) |
| InChIKey | JHUQONPNEQGFNH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|