C50H56N2O4 — CID 170256386
(4-phenylpiperidin-4-yl) 2-[5,8-dimethyl-7-[2-oxo-1-phenyl-2-(4-phenylpiperidin-4-yl)oxyethyl]-1,2,3,4,5,8-hexahydronaphthalen-2-yl]-2-phenylacetate (PubChem CID 170256386) has the molecular formula C50H56N2O4 and a molecular weight of 749.01 g/mol. Its IUPAC name is (4-phenylpiperidin-4-yl) 2-[5,8-dimethyl-7-[2-oxo-1-phenyl-2-(4-phenylpiperidin-4-yl)oxyethyl]-1,2,3,4,5,8-hexahydronaphthalen-2-yl]-2-phenylacetate.
| Compound Name | (4-phenylpiperidin-4-yl) 2-[5,8-dimethyl-7-[2-oxo-1-phenyl-2-(4-phenylpiperidin-4-yl)oxyethyl]-1,2,3,4,5,8-hexahydronaphthalen-2-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 170256386 |
| Molecular Formula | C50H56N2O4 |
| Molecular Weight | 749.01 g/mol |
| Exact Mass | 748.42 |
| IUPAC Name | (4-phenylpiperidin-4-yl) 2-[5,8-dimethyl-7-[2-oxo-1-phenyl-2-(4-phenylpiperidin-4-yl)oxyethyl]-1,2,3,4,5,8-hexahydronaphthalen-2-yl]-2-phenylacetate |
| SMILES | CC1C=C(C(C(=O)OC2(c3ccccc3)CCNCC2)c2ccccc2)C(C)C2=C1CCC(C(C(=O)OC1(c3ccccc3)CCNCC1)c1ccccc1)C2 |
| InChI | InChI=1S/C50H56N2O4/c1-35-33-44(46(38-17-9-4-10-18-38)48(54)56-50(27-31-52-32-28-50)41-21-13-6-14-22-41)36(2)43-34-39(23-24-42(35)43)45(37-15-7-3-8-16-37)47(53)55-49(25-29-51-30-26-49)40-19-11-5-12-20-40/h3-22,33,35-36,39,45-46,51-52H,23-32,34H2,1-2H3 |
| InChIKey | QICCSCPSEMVMFI-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.01 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|