C15H19F2NO2 — CID 171921911
tert-butyl N-(3,3-difluoro-1-phenylcyclobutyl)carbamate (PubChem CID 171921911) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is tert-butyl N-(3,3-difluoro-1-phenylcyclobutyl)carbamate.
| Compound Name | tert-butyl N-(3,3-difluoro-1-phenylcyclobutyl)carbamate |
|---|---|
| PubChem CID | 171921911 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | tert-butyl N-(3,3-difluoro-1-phenylcyclobutyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccccc2)CC(F)(F)C1 |
| InChI | InChI=1S/C15H19F2NO2/c1-13(2,3)20-12(19)18-14(9-15(16,17)10-14)11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3,(H,18,19) |
| InChIKey | PSLWBPJBVPAABB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |