C17H24BrNO4 — CID 118996733
tert-butyl N-[1-(3-bromophenyl)-3,3-dimethoxycyclobutyl]carbamate (PubChem CID 118996733) has the molecular formula C17H24BrNO4 and a molecular weight of 386.29 g/mol. Its IUPAC name is tert-butyl N-[1-(3-bromophenyl)-3,3-dimethoxycyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-(3-bromophenyl)-3,3-dimethoxycyclobutyl]carbamate |
|---|---|
| PubChem CID | 118996733 |
| Molecular Formula | C17H24BrNO4 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | tert-butyl N-[1-(3-bromophenyl)-3,3-dimethoxycyclobutyl]carbamate |
| SMILES | COC1(OC)CC(NC(=O)OC(C)(C)C)(c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C17H24BrNO4/c1-15(2,3)23-14(20)19-16(10-17(11-16,21-4)22-5)12-7-6-8-13(18)9-12/h6-9H,10-11H2,1-5H3,(H,19,20) |
| InChIKey | RRUFBONXXRFYIX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|