C18H27N3O2S — CID 22981119
tert-butyl N-[1-[3-(carbamothioylamino)phenyl]cyclohexyl]carbamate (PubChem CID 22981119) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(carbamothioylamino)phenyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[1-[3-(carbamothioylamino)phenyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 22981119 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | tert-butyl N-[1-[3-(carbamothioylamino)phenyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2cccc(NC(N)=S)c2)CCCCC1 |
| InChI | InChI=1S/C18H27N3O2S/c1-17(2,3)23-16(22)21-18(10-5-4-6-11-18)13-8-7-9-14(12-13)20-15(19)24/h7-9,12H,4-6,10-11H2,1-3H3,(H,21,22)(H3,19,20,24) |
| InChIKey | RGGWWSVJFLUVKA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|