C22H25ClN2O3 — CID 138554710
tert-butyl N-[1-[4-[(3-chlorobenzoyl)amino]phenyl]cyclobutyl]carbamate (PubChem CID 138554710) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[(3-chlorobenzoyl)amino]phenyl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[(3-chlorobenzoyl)amino]phenyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 138554710 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | tert-butyl N-[1-[4-[(3-chlorobenzoyl)amino]phenyl]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(NC(=O)c3cccc(Cl)c3)cc2)CCC1 |
| InChI | InChI=1S/C22H25ClN2O3/c1-21(2,3)28-20(27)25-22(12-5-13-22)16-8-10-18(11-9-16)24-19(26)15-6-4-7-17(23)14-15/h4,6-11,14H,5,12-13H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | BDYQBJYNTYITSE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |