C15H19BrFNO2 — CID 129056408
tert-butyl N-[1-(3-bromo-4-fluorophenyl)cyclobutyl]carbamate (PubChem CID 129056408) has the molecular formula C15H19BrFNO2 and a molecular weight of 344.22 g/mol. Its IUPAC name is tert-butyl N-[1-(3-bromo-4-fluorophenyl)cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-(3-bromo-4-fluorophenyl)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 129056408 |
| Molecular Formula | C15H19BrFNO2 |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | tert-butyl N-[1-(3-bromo-4-fluorophenyl)cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(F)c(Br)c2)CCC1 |
| InChI | InChI=1S/C15H19BrFNO2/c1-14(2,3)20-13(19)18-15(7-4-8-15)10-5-6-12(17)11(16)9-10/h5-6,9H,4,7-8H2,1-3H3,(H,18,19) |
| InChIKey | YCPSKFQEMURDMI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |