C19H25BrF2N2O4 — CID 166608183
tert-butyl 3-(4-bromo-2,5-difluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]azetidine-1-carboxylate (PubChem CID 166608183) has the molecular formula C19H25BrF2N2O4 and a molecular weight of 463.32 g/mol. Its IUPAC name is tert-butyl 3-(4-bromo-2,5-difluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-bromo-2,5-difluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 166608183 |
| Molecular Formula | C19H25BrF2N2O4 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | tert-butyl 3-(4-bromo-2,5-difluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NC1(c2cc(F)c(Br)cc2F)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H25BrF2N2O4/c1-17(2,3)27-15(25)23-19(11-7-14(22)12(20)8-13(11)21)9-24(10-19)16(26)28-18(4,5)6/h7-8H,9-10H2,1-6H3,(H,23,25) |
| InChIKey | DKCMSWHLTCUGKD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|