C15H18BrF2NO3 — CID 164606981
tert-butyl N-[1-[(4-bromo-2,5-difluorophenoxy)methyl]cyclopropyl]carbamate (PubChem CID 164606981) has the molecular formula C15H18BrF2NO3 and a molecular weight of 378.21 g/mol. Its IUPAC name is tert-butyl N-[1-[(4-bromo-2,5-difluorophenoxy)methyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[1-[(4-bromo-2,5-difluorophenoxy)methyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 164606981 |
| Molecular Formula | C15H18BrF2NO3 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | tert-butyl N-[1-[(4-bromo-2,5-difluorophenoxy)methyl]cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(COc2cc(F)c(Br)cc2F)CC1 |
| InChI | InChI=1S/C15H18BrF2NO3/c1-14(2,3)22-13(20)19-15(4-5-15)8-21-12-7-10(17)9(16)6-11(12)18/h6-7H,4-5,8H2,1-3H3,(H,19,20) |
| InChIKey | UBLXSNFXKAFHEE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|