C18H24FNO5 — CID 170564432
methyl 5-fluoro-2-[[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]methoxy]benzoate (PubChem CID 170564432) has the molecular formula C18H24FNO5 and a molecular weight of 353.39 g/mol. Its IUPAC name is methyl 5-fluoro-2-[[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]methoxy]benzoate.
| Compound Name | methyl 5-fluoro-2-[[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]methoxy]benzoate |
|---|---|
| PubChem CID | 170564432 |
| Molecular Formula | C18H24FNO5 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | methyl 5-fluoro-2-[[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]methoxy]benzoate |
| SMILES | COC(=O)c1cc(F)ccc1OCC1(NC(=O)OC(C)(C)C)CCC1 |
| InChI | InChI=1S/C18H24FNO5/c1-17(2,3)25-16(22)20-18(8-5-9-18)11-24-14-7-6-12(19)10-13(14)15(21)23-4/h6-7,10H,5,8-9,11H2,1-4H3,(H,20,22) |
| InChIKey | ZHUNWUCZIVHXFR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |