C17H23N3O3 — CID 90372614
tert-butyl N-[1-[(3-amino-2-cyanophenoxy)methyl]cyclobutyl]carbamate (PubChem CID 90372614) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is tert-butyl N-[1-[(3-amino-2-cyanophenoxy)methyl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[(3-amino-2-cyanophenoxy)methyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 90372614 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | tert-butyl N-[1-[(3-amino-2-cyanophenoxy)methyl]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(COc2cccc(N)c2C#N)CCC1 |
| InChI | InChI=1S/C17H23N3O3/c1-16(2,3)23-15(21)20-17(8-5-9-17)11-22-14-7-4-6-13(19)12(14)10-18/h4,6-7H,5,8-9,11,19H2,1-3H3,(H,20,21) |
| InChIKey | LABMOJDCAFAZHX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|