C17H23N3O2 — CID 66746408
2-amino-6-[[(2R)-1-(2,2-dimethylpropanoyl)pyrrolidin-2-yl]methoxy]benzonitrile (PubChem CID 66746408) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-amino-6-[[(2R)-1-(2,2-dimethylpropanoyl)pyrrolidin-2-yl]methoxy]benzonitrile.
| Compound Name | 2-amino-6-[[(2R)-1-(2,2-dimethylpropanoyl)pyrrolidin-2-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 66746408 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-amino-6-[[(2R)-1-(2,2-dimethylpropanoyl)pyrrolidin-2-yl]methoxy]benzonitrile |
| SMILES | CC(C)(C)C(=O)N1CCC[C@@H]1COc1cccc(N)c1C#N |
| InChI | InChI=1S/C17H23N3O2/c1-17(2,3)16(21)20-9-5-6-12(20)11-22-15-8-4-7-14(19)13(15)10-18/h4,7-8,12H,5-6,9,11,19H2,1-3H3/t12-/m1/s1 |
| InChIKey | IQKVUXPFKARQRU-GFCCVEGCSA-N |
| XLogP | 2.56 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|