C18H23N3O5 — CID 86714300
tert-butyl 2-[(2-cyano-3-nitrophenoxy)methyl]piperidine-1-carboxylate (PubChem CID 86714300) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is tert-butyl 2-[(2-cyano-3-nitrophenoxy)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(2-cyano-3-nitrophenoxy)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86714300 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | tert-butyl 2-[(2-cyano-3-nitrophenoxy)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1COc1cccc([N+](=O)[O-])c1C#N |
| InChI | InChI=1S/C18H23N3O5/c1-18(2,3)26-17(22)20-10-5-4-7-13(20)12-25-16-9-6-8-15(21(23)24)14(16)11-19/h6,8-9,13H,4-5,7,10,12H2,1-3H3 |
| InChIKey | QYEYUUBWVHGQDI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 105.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|