C16H23N5O4S — CID 86714295
2-[[2-cyano-3-(sulfamoylamino)phenoxy]methyl]-N-ethylpiperidine-1-carboxamide (PubChem CID 86714295) has the molecular formula C16H23N5O4S and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-[[2-cyano-3-(sulfamoylamino)phenoxy]methyl]-N-ethylpiperidine-1-carboxamide.
| Compound Name | 2-[[2-cyano-3-(sulfamoylamino)phenoxy]methyl]-N-ethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 86714295 |
| Molecular Formula | C16H23N5O4S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[[2-cyano-3-(sulfamoylamino)phenoxy]methyl]-N-ethylpiperidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCCCC1COc1cccc(NS(N)(=O)=O)c1C#N |
| InChI | InChI=1S/C16H23N5O4S/c1-2-19-16(22)21-9-4-3-6-12(21)11-25-15-8-5-7-14(13(15)10-17)20-26(18,23)24/h5,7-8,12,20H,2-4,6,9,11H2,1H3,(H,19,22)(H2,18,23,24) |
| InChIKey | KKMRORXTRCDSTF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 137.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |