C18H26N4O4S — CID 90071394
(3R)-3-[[2-cyano-3-(sulfamoylamino)phenoxy]methyl]-1-(3-methylbutanoyl)piperidine (PubChem CID 90071394) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is (3R)-3-[[2-cyano-3-(sulfamoylamino)phenoxy]methyl]-1-(3-methylbutanoyl)piperidine.
| Compound Name | (3R)-3-[[2-cyano-3-(sulfamoylamino)phenoxy]methyl]-1-(3-methylbutanoyl)piperidine |
|---|---|
| PubChem CID | 90071394 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (3R)-3-[[2-cyano-3-(sulfamoylamino)phenoxy]methyl]-1-(3-methylbutanoyl)piperidine |
| SMILES | CC(C)CC(=O)N1CCC[C@@H](COc2cccc(NS(N)(=O)=O)c2C#N)C1 |
| InChI | InChI=1S/C18H26N4O4S/c1-13(2)9-18(23)22-8-4-5-14(11-22)12-26-17-7-3-6-16(15(17)10-19)21-27(20,24)25/h3,6-7,13-14,21H,4-5,8-9,11-12H2,1-2H3,(H2,20,24,25)/t14-/m1/s1 |
| InChIKey | VKCOSIOEXQDCIK-CQSZACIVSA-N |
| XLogP | 1.84 |
| TPSA | 125.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |