C18H26N4O4S — CID 123241024
(3R)-3-[[2-isocyano-3-(sulfamoylamino)phenoxy]methyl]-1-(3-methylbutanoyl)piperidine (PubChem CID 123241024) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is (3R)-3-[[2-isocyano-3-(sulfamoylamino)phenoxy]methyl]-1-(3-methylbutanoyl)piperidine.
| Compound Name | (3R)-3-[[2-isocyano-3-(sulfamoylamino)phenoxy]methyl]-1-(3-methylbutanoyl)piperidine |
|---|---|
| PubChem CID | 123241024 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (3R)-3-[[2-isocyano-3-(sulfamoylamino)phenoxy]methyl]-1-(3-methylbutanoyl)piperidine |
| SMILES | [C-]#[N+]c1c(NS(N)(=O)=O)cccc1OC[C@@H]1CCCN(C(=O)CC(C)C)C1 |
| InChI | InChI=1S/C18H26N4O4S/c1-13(2)10-17(23)22-9-5-6-14(11-22)12-26-16-8-4-7-15(18(16)20-3)21-27(19,24)25/h4,7-8,13-14,21H,5-6,9-12H2,1-2H3,(H2,19,24,25)/t14-/m1/s1 |
| InChIKey | OHHOSISTRXHHDZ-CQSZACIVSA-N |
| XLogP | 2.52 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|