C16H23N3O4 — CID 70709054
[2-[3-[(4-methoxyphenoxy)methyl]piperidin-1-yl]-2-oxoethyl]urea (PubChem CID 70709054) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is [2-[3-[(4-methoxyphenoxy)methyl]piperidin-1-yl]-2-oxoethyl]urea.
| Compound Name | [2-[3-[(4-methoxyphenoxy)methyl]piperidin-1-yl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 70709054 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | [2-[3-[(4-methoxyphenoxy)methyl]piperidin-1-yl]-2-oxoethyl]urea |
| SMILES | COc1ccc(OCC2CCCN(C(=O)CNC(N)=O)C2)cc1 |
| InChI | InChI=1S/C16H23N3O4/c1-22-13-4-6-14(7-5-13)23-11-12-3-2-8-19(10-12)15(20)9-18-16(17)21/h4-7,12H,2-3,8-11H2,1H3,(H3,17,18,21) |
| InChIKey | FJZVSLQOUFHDGJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |