C16H23N3O3 — CID 95867203
[2-[(3S)-3-[(3-methylphenoxy)methyl]piperidin-1-yl]-2-oxoethyl]urea (PubChem CID 95867203) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is [2-[(3S)-3-[(3-methylphenoxy)methyl]piperidin-1-yl]-2-oxoethyl]urea.
| Compound Name | [2-[(3S)-3-[(3-methylphenoxy)methyl]piperidin-1-yl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 95867203 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | [2-[(3S)-3-[(3-methylphenoxy)methyl]piperidin-1-yl]-2-oxoethyl]urea |
| SMILES | Cc1cccc(OC[C@H]2CCCN(C(=O)CNC(N)=O)C2)c1 |
| InChI | InChI=1S/C16H23N3O3/c1-12-4-2-6-14(8-12)22-11-13-5-3-7-19(10-13)15(20)9-18-16(17)21/h2,4,6,8,13H,3,5,7,9-11H2,1H3,(H3,17,18,21)/t13-/m0/s1 |
| InChIKey | LYLZEYRXHHYFOH-ZDUSSCGKSA-N |
| XLogP | 1.28 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |