C20H30N2O4 — CID 70753428
1-[3-[(4-methoxyphenoxy)methyl]piperidin-1-yl]-3-morpholin-4-ylpropan-1-one (PubChem CID 70753428) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-[3-[(4-methoxyphenoxy)methyl]piperidin-1-yl]-3-morpholin-4-ylpropan-1-one.
| Compound Name | 1-[3-[(4-methoxyphenoxy)methyl]piperidin-1-yl]-3-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 70753428 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 1-[3-[(4-methoxyphenoxy)methyl]piperidin-1-yl]-3-morpholin-4-ylpropan-1-one |
| SMILES | COc1ccc(OCC2CCCN(C(=O)CCN3CCOCC3)C2)cc1 |
| InChI | InChI=1S/C20H30N2O4/c1-24-18-4-6-19(7-5-18)26-16-17-3-2-9-22(15-17)20(23)8-10-21-11-13-25-14-12-21/h4-7,17H,2-3,8-16H2,1H3 |
| InChIKey | SVVDAIBONYOFFC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |