C12H11N3O4S — CID 66746735
3-[[2-cyano-3-(sulfamoylamino)phenoxy]methyl]furan (PubChem CID 66746735) has the molecular formula C12H11N3O4S and a molecular weight of 293.30 g/mol. Its IUPAC name is 3-[[2-cyano-3-(sulfamoylamino)phenoxy]methyl]furan.
| Compound Name | 3-[[2-cyano-3-(sulfamoylamino)phenoxy]methyl]furan |
|---|---|
| PubChem CID | 66746735 |
| Molecular Formula | C12H11N3O4S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 3-[[2-cyano-3-(sulfamoylamino)phenoxy]methyl]furan |
| SMILES | N#Cc1c(NS(N)(=O)=O)cccc1OCc1ccoc1 |
| InChI | InChI=1S/C12H11N3O4S/c13-6-10-11(15-20(14,16)17)2-1-3-12(10)19-8-9-4-5-18-7-9/h1-5,7,15H,8H2,(H2,14,16,17) |
| InChIKey | VRCXNOJOCBLHKN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 118.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |