C8H10N4O2S — CID 151507260
1-(aminomethyl)-2-cyano-3-(sulfamoylamino)benzene (PubChem CID 151507260) has the molecular formula C8H10N4O2S and a molecular weight of 226.26 g/mol. Its IUPAC name is 1-(aminomethyl)-2-cyano-3-(sulfamoylamino)benzene.
| Compound Name | 1-(aminomethyl)-2-cyano-3-(sulfamoylamino)benzene |
|---|---|
| PubChem CID | 151507260 |
| Molecular Formula | C8H10N4O2S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 1-(aminomethyl)-2-cyano-3-(sulfamoylamino)benzene |
| SMILES | N#Cc1c(CN)cccc1NS(N)(=O)=O |
| InChI | InChI=1S/C8H10N4O2S/c9-4-6-2-1-3-8(7(6)5-10)12-15(11,13)14/h1-3,12H,4,9H2,(H2,11,13,14) |
| InChIKey | PRRQVZZSVZMHCI-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |