C10H11N3O2S — CID 67399580
2-cyano-1-prop-1-en-2-yl-3-(sulfamoylamino)benzene (PubChem CID 67399580) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-cyano-1-prop-1-en-2-yl-3-(sulfamoylamino)benzene.
| Compound Name | 2-cyano-1-prop-1-en-2-yl-3-(sulfamoylamino)benzene |
|---|---|
| PubChem CID | 67399580 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-cyano-1-prop-1-en-2-yl-3-(sulfamoylamino)benzene |
| SMILES | C=C(C)c1cccc(NS(N)(=O)=O)c1C#N |
| InChI | InChI=1S/C10H11N3O2S/c1-7(2)8-4-3-5-10(9(8)6-11)13-16(12,14)15/h3-5,13H,1H2,2H3,(H2,12,14,15) |
| InChIKey | WSGXIBJIXMIQFK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |