C12H18N4O6S2 — CID 150470910
5-[2-cyano-3-(sulfamoylamino)phenoxy]pentylsulfamic acid (PubChem CID 150470910) has the molecular formula C12H18N4O6S2 and a molecular weight of 378.43 g/mol. Its IUPAC name is 5-[2-cyano-3-(sulfamoylamino)phenoxy]pentylsulfamic acid.
| Compound Name | 5-[2-cyano-3-(sulfamoylamino)phenoxy]pentylsulfamic acid |
|---|---|
| PubChem CID | 150470910 |
| Molecular Formula | C12H18N4O6S2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 5-[2-cyano-3-(sulfamoylamino)phenoxy]pentylsulfamic acid |
| SMILES | N#Cc1c(NS(N)(=O)=O)cccc1OCCCCCNS(=O)(=O)O |
| InChI | InChI=1S/C12H18N4O6S2/c13-9-10-11(16-23(14,17)18)5-4-6-12(10)22-8-3-1-2-7-15-24(19,20)21/h4-6,15-16H,1-3,7-8H2,(H2,14,17,18)(H,19,20,21) |
| InChIKey | HRTTWYCYGANUMC-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 171.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|