C19H27N3O4 — CID 66746064
[1-[6-(3-amino-2-cyanophenoxy)hexylamino]-2-methyl-1-oxopropan-2-yl] acetate (PubChem CID 66746064) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is [1-[6-(3-amino-2-cyanophenoxy)hexylamino]-2-methyl-1-oxopropan-2-yl] acetate.
| Compound Name | [1-[6-(3-amino-2-cyanophenoxy)hexylamino]-2-methyl-1-oxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 66746064 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | [1-[6-(3-amino-2-cyanophenoxy)hexylamino]-2-methyl-1-oxopropan-2-yl] acetate |
| SMILES | CC(=O)OC(C)(C)C(=O)NCCCCCCOc1cccc(N)c1C#N |
| InChI | InChI=1S/C19H27N3O4/c1-14(23)26-19(2,3)18(24)22-11-6-4-5-7-12-25-17-10-8-9-16(21)15(17)13-20/h8-10H,4-7,11-12,21H2,1-3H3,(H,22,24) |
| InChIKey | IZOVBOSFLMMBOC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|