C23H28N2O4 — CID 68842090
tert-butyl N-[4-(2-cyano-3-phenylmethoxyphenoxy)butyl]carbamate (PubChem CID 68842090) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is tert-butyl N-[4-(2-cyano-3-phenylmethoxyphenoxy)butyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-cyano-3-phenylmethoxyphenoxy)butyl]carbamate |
|---|---|
| PubChem CID | 68842090 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | tert-butyl N-[4-(2-cyano-3-phenylmethoxyphenoxy)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCOc1cccc(OCc2ccccc2)c1C#N |
| InChI | InChI=1S/C23H28N2O4/c1-23(2,3)29-22(26)25-14-7-8-15-27-20-12-9-13-21(19(20)16-24)28-17-18-10-5-4-6-11-18/h4-6,9-13H,7-8,14-15,17H2,1-3H3,(H,25,26) |
| InChIKey | OYVQQJJCJIRSMB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|