C16H22N2O4 — CID 68838450
tert-butyl N-[4-(2-cyano-3-hydroxyphenoxy)butyl]carbamate (PubChem CID 68838450) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is tert-butyl N-[4-(2-cyano-3-hydroxyphenoxy)butyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-cyano-3-hydroxyphenoxy)butyl]carbamate |
|---|---|
| PubChem CID | 68838450 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | tert-butyl N-[4-(2-cyano-3-hydroxyphenoxy)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCOc1cccc(O)c1C#N |
| InChI | InChI=1S/C16H22N2O4/c1-16(2,3)22-15(20)18-9-4-5-10-21-14-8-6-7-13(19)12(14)11-17/h6-8,19H,4-5,9-10H2,1-3H3,(H,18,20) |
| InChIKey | JPSKHDXQZJDVSQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|