C23H31NO6S — CID 68837997
tert-butyl N-[4-(2-methylsulfonyl-3-phenylmethoxyphenoxy)butyl]carbamate (PubChem CID 68837997) has the molecular formula C23H31NO6S and a molecular weight of 449.57 g/mol. Its IUPAC name is tert-butyl N-[4-(2-methylsulfonyl-3-phenylmethoxyphenoxy)butyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-methylsulfonyl-3-phenylmethoxyphenoxy)butyl]carbamate |
|---|---|
| PubChem CID | 68837997 |
| Molecular Formula | C23H31NO6S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | tert-butyl N-[4-(2-methylsulfonyl-3-phenylmethoxyphenoxy)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCOc1cccc(OCc2ccccc2)c1S(C)(=O)=O |
| InChI | InChI=1S/C23H31NO6S/c1-23(2,3)30-22(25)24-15-8-9-16-28-19-13-10-14-20(21(19)31(4,26)27)29-17-18-11-6-5-7-12-18/h5-7,10-14H,8-9,15-17H2,1-4H3,(H,24,25) |
| InChIKey | DHWQSSVGSIQILQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|