C23H31NO5S — CID 68839645
tert-butyl N-[4-(2-methylsulfinyl-3-phenylmethoxyphenoxy)butyl]carbamate (PubChem CID 68839645) has the molecular formula C23H31NO5S and a molecular weight of 433.57 g/mol. Its IUPAC name is tert-butyl N-[4-(2-methylsulfinyl-3-phenylmethoxyphenoxy)butyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-methylsulfinyl-3-phenylmethoxyphenoxy)butyl]carbamate |
|---|---|
| PubChem CID | 68839645 |
| Molecular Formula | C23H31NO5S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | tert-butyl N-[4-(2-methylsulfinyl-3-phenylmethoxyphenoxy)butyl]carbamate |
| SMILES | CS(=O)c1c(OCCCCNC(=O)OC(C)(C)C)cccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H31NO5S/c1-23(2,3)29-22(25)24-15-8-9-16-27-19-13-10-14-20(21(19)30(4)26)28-17-18-11-6-5-7-12-18/h5-7,10-14H,8-9,15-17H2,1-4H3,(H,24,25) |
| InChIKey | RBFZOXTZKMZGOA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|