C13H17N3O2S — CID 142767218
2-cyano-1-cyclohexyl-3-(sulfamoylamino)benzene (PubChem CID 142767218) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-cyano-1-cyclohexyl-3-(sulfamoylamino)benzene.
| Compound Name | 2-cyano-1-cyclohexyl-3-(sulfamoylamino)benzene |
|---|---|
| PubChem CID | 142767218 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-cyano-1-cyclohexyl-3-(sulfamoylamino)benzene |
| SMILES | N#Cc1c(NS(N)(=O)=O)cccc1C1CCCCC1 |
| InChI | InChI=1S/C13H17N3O2S/c14-9-12-11(10-5-2-1-3-6-10)7-4-8-13(12)16-19(15,17)18/h4,7-8,10,16H,1-3,5-6H2,(H2,15,17,18) |
| InChIKey | YFRXXJPFYOKOAA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |