C17H24INO3 — CID 164607130
tert-butyl N-[1-[(4-iodo-3,5-dimethylphenoxy)methyl]cyclopropyl]carbamate (PubChem CID 164607130) has the molecular formula C17H24INO3 and a molecular weight of 417.29 g/mol. Its IUPAC name is tert-butyl N-[1-[(4-iodo-3,5-dimethylphenoxy)methyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[1-[(4-iodo-3,5-dimethylphenoxy)methyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 164607130 |
| Molecular Formula | C17H24INO3 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | tert-butyl N-[1-[(4-iodo-3,5-dimethylphenoxy)methyl]cyclopropyl]carbamate |
| SMILES | Cc1cc(OCC2(NC(=O)OC(C)(C)C)CC2)cc(C)c1I |
| InChI | InChI=1S/C17H24INO3/c1-11-8-13(9-12(2)14(11)18)21-10-17(6-7-17)19-15(20)22-16(3,4)5/h8-9H,6-7,10H2,1-5H3,(H,19,20) |
| InChIKey | YVWWCWSPSVZQLP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|