C24H19ClF2N2O2 — CID 138543815
N-[1-[4-[(3-chlorobenzoyl)amino]phenyl]cyclobutyl]-3,4-difluorobenzamide (PubChem CID 138543815) has the molecular formula C24H19ClF2N2O2 and a molecular weight of 440.88 g/mol. Its IUPAC name is N-[1-[4-[(3-chlorobenzoyl)amino]phenyl]cyclobutyl]-3,4-difluorobenzamide.
| Compound Name | N-[1-[4-[(3-chlorobenzoyl)amino]phenyl]cyclobutyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 138543815 |
| Molecular Formula | C24H19ClF2N2O2 |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | N-[1-[4-[(3-chlorobenzoyl)amino]phenyl]cyclobutyl]-3,4-difluorobenzamide |
| SMILES | O=C(Nc1ccc(C2(NC(=O)c3ccc(F)c(F)c3)CCC2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H19ClF2N2O2/c25-18-4-1-3-15(13-18)22(30)28-19-8-6-17(7-9-19)24(11-2-12-24)29-23(31)16-5-10-20(26)21(27)14-16/h1,3-10,13-14H,2,11-12H2,(H,28,30)(H,29,31) |
| InChIKey | UTWBBKZKELHZIB-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |