C18H27BrN2O3 — CID 142873960
tert-butyl N-[(2S)-4-[[1-(3-bromophenyl)cyclopropyl]amino]-3-hydroxybutan-2-yl]carbamate (PubChem CID 142873960) has the molecular formula C18H27BrN2O3 and a molecular weight of 399.33 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-[[1-(3-bromophenyl)cyclopropyl]amino]-3-hydroxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-[[1-(3-bromophenyl)cyclopropyl]amino]-3-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142873960 |
| Molecular Formula | C18H27BrN2O3 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | tert-butyl N-[(2S)-4-[[1-(3-bromophenyl)cyclopropyl]amino]-3-hydroxybutan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(O)CNC1(c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C18H27BrN2O3/c1-12(21-16(23)24-17(2,3)4)15(22)11-20-18(8-9-18)13-6-5-7-14(19)10-13/h5-7,10,12,15,20,22H,8-9,11H2,1-4H3,(H,21,23)/t12-,15?/m0/s1 |
| InChIKey | QKENJBPFKFLJBQ-SFVWDYPZSA-N |
| XLogP | 3.30 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |