C12H18F2N4O2 — CID 154685457
tert-butyl N-[3,3-difluoro-1-(2H-triazol-4-yl)cyclopentyl]carbamate (PubChem CID 154685457) has the molecular formula C12H18F2N4O2 and a molecular weight of 288.30 g/mol. Its IUPAC name is tert-butyl N-[3,3-difluoro-1-(2H-triazol-4-yl)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[3,3-difluoro-1-(2H-triazol-4-yl)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 154685457 |
| Molecular Formula | C12H18F2N4O2 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | tert-butyl N-[3,3-difluoro-1-(2H-triazol-4-yl)cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2cn[nH]n2)CCC(F)(F)C1 |
| InChI | InChI=1S/C12H18F2N4O2/c1-10(2,3)20-9(19)16-11(8-6-15-18-17-8)4-5-12(13,14)7-11/h6H,4-5,7H2,1-3H3,(H,16,19)(H,15,17,18) |
| InChIKey | CKKUFWMCQLPXCG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |