C13H29NO2 — CID 144869445
tert-butyl N-(1-methylcyclopropyl)carbamate;ethane (PubChem CID 144869445) has the molecular formula C13H29NO2 and a molecular weight of 231.38 g/mol. Its IUPAC name is tert-butyl N-(1-methylcyclopropyl)carbamate;ethane.
| Compound Name | tert-butyl N-(1-methylcyclopropyl)carbamate;ethane |
|---|---|
| PubChem CID | 144869445 |
| Molecular Formula | C13H29NO2 |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | tert-butyl N-(1-methylcyclopropyl)carbamate;ethane |
| SMILES | CC.CC.CC1(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C9H17NO2.2C2H6/c1-8(2,3)12-7(11)10-9(4)5-6-9;2*1-2/h5-6H2,1-4H3,(H,10,11);2*1-2H3 |
| InChIKey | BOVYTIXBHDWRQZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |