C15H30N2O3 — CID 154784625
tert-butyl N-[4-[[(2R)-1-hydroxypropan-2-yl]amino]-1-methylcyclohexyl]carbamate (PubChem CID 154784625) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is tert-butyl N-[4-[[(2R)-1-hydroxypropan-2-yl]amino]-1-methylcyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(2R)-1-hydroxypropan-2-yl]amino]-1-methylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 154784625 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | tert-butyl N-[4-[[(2R)-1-hydroxypropan-2-yl]amino]-1-methylcyclohexyl]carbamate |
| SMILES | C[C@H](CO)NC1CCC(C)(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H30N2O3/c1-11(10-18)16-12-6-8-15(5,9-7-12)17-13(19)20-14(2,3)4/h11-12,16,18H,6-10H2,1-5H3,(H,17,19)/t11-,12?,15?/m1/s1 |
| InChIKey | RYQJANRKAGGFQR-XIKARTHZSA-N |
| XLogP | 2.18 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |