C10H18F3NO2 — CID 103788987
4-[[(2S)-1-hydroxypropan-2-yl]amino]-1-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 103788987) has the molecular formula C10H18F3NO2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 4-[[(2S)-1-hydroxypropan-2-yl]amino]-1-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 4-[[(2S)-1-hydroxypropan-2-yl]amino]-1-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 103788987 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 4-[[(2S)-1-hydroxypropan-2-yl]amino]-1-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | C[C@@H](CO)NC1CCC(O)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H18F3NO2/c1-7(6-15)14-8-2-4-9(16,5-3-8)10(11,12)13/h7-8,14-16H,2-6H2,1H3/t7-,8?,9?/m0/s1 |
| InChIKey | JLAAWWZUIJEMGW-UEJVZZJDSA-N |
| XLogP | 1.19 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |