C14H30N2O2 — CID 142326878
tert-butyl N-(1,4-dimethylpiperidin-4-yl)carbamate;ethane (PubChem CID 142326878) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is tert-butyl N-(1,4-dimethylpiperidin-4-yl)carbamate;ethane.
| Compound Name | tert-butyl N-(1,4-dimethylpiperidin-4-yl)carbamate;ethane |
|---|---|
| PubChem CID | 142326878 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | tert-butyl N-(1,4-dimethylpiperidin-4-yl)carbamate;ethane |
| SMILES | CC.CN1CCC(C)(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H24N2O2.C2H6/c1-11(2,3)16-10(15)13-12(4)6-8-14(5)9-7-12;1-2/h6-9H2,1-5H3,(H,13,15);1-2H3 |
| InChIKey | WYLMOBCZEKTRKH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |