About N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane
N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane (PubChem CID 142327060) has the molecular formula C15H32N2O
and a molecular weight of 256.43 g/mol. Its IUPAC name is N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane.
Molecular Properties
| Compound Name | N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane |
| PubChem CID | 142327060 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane |
| SMILES | CC.CN1CCC(C)(NC(=O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H26N2O.C2H6/c1-12(2,3)10-11(16)14-13(4)6-8-15(5)9-7-13;1-2/h6-10H2,1-5H3,(H,14,16);1-2H3 |
| InChIKey | WSWNIJIERXSLOG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane?
The IUPAC name of N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane (CID 142327060) is N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane.
What is the SMILES notation for N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane?
The canonical SMILES for N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane is CC.CN1CCC(C)(NC(=O)CC(C)(C)C)CC1.
What is the InChIKey of N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane?
The InChIKey is WSWNIJIERXSLOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O.C2H6/c1-12(2,3)10-11(16)14-13(4)6-8-15(5)9-7-13;1-2/h6-10H2,1-5H3,(H,14,16);1-2H3.
What are the key properties of N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane?
N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane has a molecular weight of 256.43 g/mol, XLogP of 3.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane is sourced from PubChem (CID 142327060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).