C15H32N2O — CID 142327060
N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane (PubChem CID 142327060) has the molecular formula C15H32N2O and a molecular weight of 256.43 g/mol. Its IUPAC name is N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane.
| Compound Name | N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane |
|---|---|
| PubChem CID | 142327060 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | N-(1,4-dimethylpiperidin-4-yl)-3,3-dimethylbutanamide;ethane |
| SMILES | CC.CN1CCC(C)(NC(=O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H26N2O.C2H6/c1-12(2,3)10-11(16)14-13(4)6-8-15(5)9-7-13;1-2/h6-10H2,1-5H3,(H,14,16);1-2H3 |
| InChIKey | WSWNIJIERXSLOG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |