C9H19N3O4S — CID 167723970
tert-butyl N-(3-methyl-1-sulfamoylazetidin-3-yl)carbamate (PubChem CID 167723970) has the molecular formula C9H19N3O4S and a molecular weight of 265.33 g/mol. Its IUPAC name is tert-butyl N-(3-methyl-1-sulfamoylazetidin-3-yl)carbamate.
| Compound Name | tert-butyl N-(3-methyl-1-sulfamoylazetidin-3-yl)carbamate |
|---|---|
| PubChem CID | 167723970 |
| Molecular Formula | C9H19N3O4S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | tert-butyl N-(3-methyl-1-sulfamoylazetidin-3-yl)carbamate |
| SMILES | CC1(NC(=O)OC(C)(C)C)CN(S(N)(=O)=O)C1 |
| InChI | InChI=1S/C9H19N3O4S/c1-8(2,3)16-7(13)11-9(4)5-12(6-9)17(10,14)15/h5-6H2,1-4H3,(H,11,13)(H2,10,14,15) |
| InChIKey | UEERYVSHIQRWHU-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |