C13H20N4O2 — CID 139373990
tert-butyl N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)carbamate (PubChem CID 139373990) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is tert-butyl N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)carbamate.
| Compound Name | tert-butyl N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)carbamate |
|---|---|
| PubChem CID | 139373990 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | tert-butyl N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)carbamate |
| SMILES | CC1(NC(=O)OC(C)(C)C)CN(c2cccnn2)C1 |
| InChI | InChI=1S/C13H20N4O2/c1-12(2,3)19-11(18)15-13(4)8-17(9-13)10-6-5-7-14-16-10/h5-7H,8-9H2,1-4H3,(H,15,18) |
| InChIKey | YNOOJZBQSXEZKC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |