C15H24N4O2 — CID 175845552
tert-butyl N-[1-(5-deuteriopyrazin-2-yl)-4-methylpiperidin-4-yl]carbamate (PubChem CID 175845552) has the molecular formula C15H24N4O2 and a molecular weight of 293.39 g/mol. Its IUPAC name is tert-butyl N-[1-(5-deuteriopyrazin-2-yl)-4-methylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(5-deuteriopyrazin-2-yl)-4-methylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 175845552 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | tert-butyl N-[1-(5-deuteriopyrazin-2-yl)-4-methylpiperidin-4-yl]carbamate |
| SMILES | [2H]c1cnc(N2CCC(C)(NC(=O)OC(C)(C)C)CC2)cn1 |
| InChI | InChI=1S/C15H24N4O2/c1-14(2,3)21-13(20)18-15(4)5-9-19(10-6-15)12-11-16-7-8-17-12/h7-8,11H,5-6,9-10H2,1-4H3,(H,18,20)/i7D |
| InChIKey | PQZMMLCDNPHTGT-WHRKIXHSSA-N |
| XLogP | 2.36 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |