C16H26N4O2 — CID 175835276
tert-butyl N-[[1-(5-deuteriopyrazin-2-yl)-4-methylpiperidin-4-yl]methyl]carbamate (PubChem CID 175835276) has the molecular formula C16H26N4O2 and a molecular weight of 307.42 g/mol. Its IUPAC name is tert-butyl N-[[1-(5-deuteriopyrazin-2-yl)-4-methylpiperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(5-deuteriopyrazin-2-yl)-4-methylpiperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 175835276 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | tert-butyl N-[[1-(5-deuteriopyrazin-2-yl)-4-methylpiperidin-4-yl]methyl]carbamate |
| SMILES | [2H]c1cnc(N2CCC(C)(CNC(=O)OC(C)(C)C)CC2)cn1 |
| InChI | InChI=1S/C16H26N4O2/c1-15(2,3)22-14(21)19-12-16(4)5-9-20(10-6-16)13-11-17-7-8-18-13/h7-8,11H,5-6,9-10,12H2,1-4H3,(H,19,21)/i7D |
| InChIKey | GJWSNJAGEARRIR-WHRKIXHSSA-N |
| XLogP | 2.61 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |