C16H24BrN5O4 — CID 142403906
tert-butyl N-[1-(4-amino-5-bromo-3-nitro-2-pyridinyl)-4-methylpiperidin-4-yl]carbamate (PubChem CID 142403906) has the molecular formula C16H24BrN5O4 and a molecular weight of 430.30 g/mol. Its IUPAC name is tert-butyl N-[1-(4-amino-5-bromo-3-nitro-2-pyridinyl)-4-methylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-amino-5-bromo-3-nitro-2-pyridinyl)-4-methylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 142403906 |
| Molecular Formula | C16H24BrN5O4 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | tert-butyl N-[1-(4-amino-5-bromo-3-nitro-2-pyridinyl)-4-methylpiperidin-4-yl]carbamate |
| SMILES | CC1(NC(=O)OC(C)(C)C)CCN(c2ncc(Br)c(N)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H24BrN5O4/c1-15(2,3)26-14(23)20-16(4)5-7-21(8-6-16)13-12(22(24)25)11(18)10(17)9-19-13/h9H,5-8H2,1-4H3,(H2,18,19)(H,20,23) |
| InChIKey | WCCIVECAAXCNSG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|