C17H26BrN3O2 — CID 175043302
tert-butyl N-[1-(6-bromo-4-methyl-2-pyridinyl)-4-methylpiperidin-4-yl]carbamate (PubChem CID 175043302) has the molecular formula C17H26BrN3O2 and a molecular weight of 384.32 g/mol. Its IUPAC name is tert-butyl N-[1-(6-bromo-4-methyl-2-pyridinyl)-4-methylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(6-bromo-4-methyl-2-pyridinyl)-4-methylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 175043302 |
| Molecular Formula | C17H26BrN3O2 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | tert-butyl N-[1-(6-bromo-4-methyl-2-pyridinyl)-4-methylpiperidin-4-yl]carbamate |
| SMILES | Cc1cc(Br)nc(N2CCC(C)(NC(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C17H26BrN3O2/c1-12-10-13(18)19-14(11-12)21-8-6-17(5,7-9-21)20-15(22)23-16(2,3)4/h10-11H,6-9H2,1-5H3,(H,20,22) |
| InChIKey | HDSJREGIIJUHRK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|