C9H19NO4S — CID 171922241
tert-butyl N-(1,1-dihydroxy-3-methylthietan-3-yl)carbamate (PubChem CID 171922241) has the molecular formula C9H19NO4S and a molecular weight of 237.32 g/mol. Its IUPAC name is tert-butyl N-(1,1-dihydroxy-3-methylthietan-3-yl)carbamate.
| Compound Name | tert-butyl N-(1,1-dihydroxy-3-methylthietan-3-yl)carbamate |
|---|---|
| PubChem CID | 171922241 |
| Molecular Formula | C9H19NO4S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | tert-butyl N-(1,1-dihydroxy-3-methylthietan-3-yl)carbamate |
| SMILES | CC1(NC(=O)OC(C)(C)C)CS(O)(O)C1 |
| InChI | InChI=1S/C9H19NO4S/c1-8(2,3)14-7(11)10-9(4)5-15(12,13)6-9/h12-13H,5-6H2,1-4H3,(H,10,11) |
| InChIKey | RRHDDHWUVYQULD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |