C19H22N2O2 — CID 141105169
tert-butyl N-[1-(5-phenyl-2-pyridinyl)cyclopropyl]carbamate (PubChem CID 141105169) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is tert-butyl N-[1-(5-phenyl-2-pyridinyl)cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[1-(5-phenyl-2-pyridinyl)cyclopropyl]carbamate |
|---|---|
| PubChem CID | 141105169 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | tert-butyl N-[1-(5-phenyl-2-pyridinyl)cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(-c3ccccc3)cn2)CC1 |
| InChI | InChI=1S/C19H22N2O2/c1-18(2,3)23-17(22)21-19(11-12-19)16-10-9-15(13-20-16)14-7-5-4-6-8-14/h4-10,13H,11-12H2,1-3H3,(H,21,22) |
| InChIKey | NFXYSIVBMWGAQX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |