C13H19ClN4O2 — CID 118542732
tert-butyl N-[(3R)-3-(6-chloropyridazin-3-yl)pyrrolidin-3-yl]carbamate (PubChem CID 118542732) has the molecular formula C13H19ClN4O2 and a molecular weight of 298.77 g/mol. Its IUPAC name is tert-butyl N-[(3R)-3-(6-chloropyridazin-3-yl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-3-(6-chloropyridazin-3-yl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 118542732 |
| Molecular Formula | C13H19ClN4O2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | tert-butyl N-[(3R)-3-(6-chloropyridazin-3-yl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@]1(c2ccc(Cl)nn2)CCNC1 |
| InChI | InChI=1S/C13H19ClN4O2/c1-12(2,3)20-11(19)16-13(6-7-15-8-13)9-4-5-10(14)18-17-9/h4-5,15H,6-8H2,1-3H3,(H,16,19)/t13-/m1/s1 |
| InChIKey | OUOARCLTCIRJFR-CYBMUJFWSA-N |
| XLogP | 1.84 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |